C27H40NOY+ — CID 160611315
1-benzyl-1-[2-(2-methyl-5-pentylphenoxy)ethyl]azepan-1-ium;yttrium (PubChem CID 160611315) has the molecular formula C27H40NOY+ and a molecular weight of 483.53 g/mol. Its IUPAC name is 1-benzyl-1-[2-(2-methyl-5-pentylphenoxy)ethyl]azepan-1-ium;yttrium.
| Compound Name | 1-benzyl-1-[2-(2-methyl-5-pentylphenoxy)ethyl]azepan-1-ium;yttrium |
|---|---|
| PubChem CID | 160611315 |
| Molecular Formula | C27H40NOY+ |
| Molecular Weight | 483.53 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | 1-benzyl-1-[2-(2-methyl-5-pentylphenoxy)ethyl]azepan-1-ium;yttrium |
| SMILES | CCCCCc1ccc(C)c(OCC[N+]2(Cc3ccccc3)CCCCCC2)c1.[Y] |
| InChI | InChI=1S/C27H40NO.Y/c1-3-4-8-13-25-17-16-24(2)27(22-25)29-21-20-28(18-11-5-6-12-19-28)23-26-14-9-7-10-15-26;/h7,9-10,14-17,22H,3-6,8,11-13,18-21,23H2,1-2H3;/q+1; |
| InChIKey | GNFGETQFQDIDLY-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.53 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|