C23H32NO2Y+ — CID 158251887
4-benzyl-4-[3-(2,6-dimethylphenoxy)propyl]-1,4-oxazepan-4-ium;yttrium (PubChem CID 158251887) has the molecular formula C23H32NO2Y+ and a molecular weight of 443.42 g/mol. Its IUPAC name is 4-benzyl-4-[3-(2,6-dimethylphenoxy)propyl]-1,4-oxazepan-4-ium;yttrium.
| Compound Name | 4-benzyl-4-[3-(2,6-dimethylphenoxy)propyl]-1,4-oxazepan-4-ium;yttrium |
|---|---|
| PubChem CID | 158251887 |
| Molecular Formula | C23H32NO2Y+ |
| Molecular Weight | 443.42 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | 4-benzyl-4-[3-(2,6-dimethylphenoxy)propyl]-1,4-oxazepan-4-ium;yttrium |
| SMILES | Cc1cccc(C)c1OCCC[N+]1(Cc2ccccc2)CCCOCC1.[Y] |
| InChI | InChI=1S/C23H32NO2.Y/c1-20-9-6-10-21(2)23(20)26-17-8-14-24(13-7-16-25-18-15-24)19-22-11-4-3-5-12-22;/h3-6,9-12H,7-8,13-19H2,1-2H3;/q+1; |
| InChIKey | QNHUVXOXZWCUCI-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.42 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|