C27H39FNOY+ — CID 157135763
1-benzyl-1-[7-(2-fluoro-6-methylphenoxy)heptan-3-yl]azepan-1-ium;yttrium (PubChem CID 157135763) has the molecular formula C27H39FNOY+ and a molecular weight of 501.52 g/mol. Its IUPAC name is 1-benzyl-1-[7-(2-fluoro-6-methylphenoxy)heptan-3-yl]azepan-1-ium;yttrium.
| Compound Name | 1-benzyl-1-[7-(2-fluoro-6-methylphenoxy)heptan-3-yl]azepan-1-ium;yttrium |
|---|---|
| PubChem CID | 157135763 |
| Molecular Formula | C27H39FNOY+ |
| Molecular Weight | 501.52 g/mol |
| Exact Mass | 501.21 |
| IUPAC Name | 1-benzyl-1-[7-(2-fluoro-6-methylphenoxy)heptan-3-yl]azepan-1-ium;yttrium |
| SMILES | CCC(CCCCOc1c(C)cccc1F)[N+]1(Cc2ccccc2)CCCCCC1.[Y] |
| InChI | InChI=1S/C27H39FNO.Y/c1-3-25(17-9-12-21-30-27-23(2)14-13-18-26(27)28)29(19-10-4-5-11-20-29)22-24-15-7-6-8-16-24;/h6-8,13-16,18,25H,3-5,9-12,17,19-22H2,1-2H3;/q+1; |
| InChIKey | YDQBIXLAWVXYNP-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.52 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|