C25H34NO3Y+ — CID 158323371
2-[1-[2-(2,6-dimethylphenoxy)ethyl]azepan-1-ium-1-yl]ethyl benzoate;yttrium (PubChem CID 158323371) has the molecular formula C25H34NO3Y+ and a molecular weight of 485.46 g/mol. Its IUPAC name is 2-[1-[2-(2,6-dimethylphenoxy)ethyl]azepan-1-ium-1-yl]ethyl benzoate;yttrium.
| Compound Name | 2-[1-[2-(2,6-dimethylphenoxy)ethyl]azepan-1-ium-1-yl]ethyl benzoate;yttrium |
|---|---|
| PubChem CID | 158323371 |
| Molecular Formula | C25H34NO3Y+ |
| Molecular Weight | 485.46 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | 2-[1-[2-(2,6-dimethylphenoxy)ethyl]azepan-1-ium-1-yl]ethyl benzoate;yttrium |
| SMILES | Cc1cccc(C)c1OCC[N+]1(CCOC(=O)c2ccccc2)CCCCCC1.[Y] |
| InChI | InChI=1S/C25H34NO3.Y/c1-21-11-10-12-22(2)24(21)28-19-17-26(15-8-3-4-9-16-26)18-20-29-25(27)23-13-6-5-7-14-23;/h5-7,10-14H,3-4,8-9,15-20H2,1-2H3;/q+1; |
| InChIKey | GWPNVRRKUIPWBD-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.46 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|