C22H30NO2Y+ — CID 161144518
4-benzyl-4-[2-(2,6-dimethylphenoxy)ethyl]-1,4-oxazepan-4-ium;yttrium (PubChem CID 161144518) has the molecular formula C22H30NO2Y+ and a molecular weight of 429.39 g/mol. Its IUPAC name is 4-benzyl-4-[2-(2,6-dimethylphenoxy)ethyl]-1,4-oxazepan-4-ium;yttrium.
| Compound Name | 4-benzyl-4-[2-(2,6-dimethylphenoxy)ethyl]-1,4-oxazepan-4-ium;yttrium |
|---|---|
| PubChem CID | 161144518 |
| Molecular Formula | C22H30NO2Y+ |
| Molecular Weight | 429.39 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | 4-benzyl-4-[2-(2,6-dimethylphenoxy)ethyl]-1,4-oxazepan-4-ium;yttrium |
| SMILES | Cc1cccc(C)c1OCC[N+]1(Cc2ccccc2)CCCOCC1.[Y] |
| InChI | InChI=1S/C22H30NO2.Y/c1-19-8-6-9-20(2)22(19)25-17-14-23(12-7-15-24-16-13-23)18-21-10-4-3-5-11-21;/h3-6,8-11H,7,12-18H2,1-2H3;/q+1; |
| InChIKey | GKDGTZLSVDBJHW-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.39 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|