C24H34NO2Y+ — CID 159977735
1-benzyl-1-[2-(2,6-dimethylphenoxy)ethyl]-4-methoxyazepan-1-ium;yttrium (PubChem CID 159977735) has the molecular formula C24H34NO2Y+ and a molecular weight of 457.45 g/mol. Its IUPAC name is 1-benzyl-1-[2-(2,6-dimethylphenoxy)ethyl]-4-methoxyazepan-1-ium;yttrium.
| Compound Name | 1-benzyl-1-[2-(2,6-dimethylphenoxy)ethyl]-4-methoxyazepan-1-ium;yttrium |
|---|---|
| PubChem CID | 159977735 |
| Molecular Formula | C24H34NO2Y+ |
| Molecular Weight | 457.45 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | 1-benzyl-1-[2-(2,6-dimethylphenoxy)ethyl]-4-methoxyazepan-1-ium;yttrium |
| SMILES | COC1CCC[N+](CCOc2c(C)cccc2C)(Cc2ccccc2)CC1.[Y] |
| InChI | InChI=1S/C24H34NO2.Y/c1-20-9-7-10-21(2)24(20)27-18-17-25(19-22-11-5-4-6-12-22)15-8-13-23(26-3)14-16-25;/h4-7,9-12,23H,8,13-19H2,1-3H3;/q+1; |
| InChIKey | KJHGPYLXMDCIQB-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.45 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|