C26H40NO3+ — CID 51696307
(2S)-1-[4-(1-adamantyl)phenoxy]-3-[(2S,6S)-2,4,6-trimethylmorpholin-4-ium-4-yl]propan-2-ol (PubChem CID 51696307) has the molecular formula C26H40NO3+ and a molecular weight of 414.61 g/mol. Its IUPAC name is (2S)-1-[4-(1-adamantyl)phenoxy]-3-[(2S,6S)-2,4,6-trimethylmorpholin-4-ium-4-yl]propan-2-ol.
| Compound Name | (2S)-1-[4-(1-adamantyl)phenoxy]-3-[(2S,6S)-2,4,6-trimethylmorpholin-4-ium-4-yl]propan-2-ol |
|---|---|
| PubChem CID | 51696307 |
| Molecular Formula | C26H40NO3+ |
| Molecular Weight | 414.61 g/mol |
| Exact Mass | 414.30 |
| IUPAC Name | (2S)-1-[4-(1-adamantyl)phenoxy]-3-[(2S,6S)-2,4,6-trimethylmorpholin-4-ium-4-yl]propan-2-ol |
| SMILES | C[C@H]1C[N+](C)(C[C@H](O)COc2ccc(C34CC5CC(CC(C5)C3)C4)cc2)C[C@H](C)O1 |
| InChI | InChI=1S/C26H40NO3/c1-18-14-27(3,15-19(2)30-18)16-24(28)17-29-25-6-4-23(5-7-25)26-11-20-8-21(12-26)10-22(9-20)13-26/h4-7,18-22,24,28H,8-17H2,1-3H3/q+1/t18-,19-,20?,21?,22?,24-,26?/m0/s1 |
| InChIKey | WQFLNSXSYZARDX-BSJQURJQSA-N |
| XLogP | 4.15 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.61 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|