C21H24N4O7S — CID 91338886
2-(2-amino-1,3-thiazol-4-yl)-N-[4-[1,1-dihydroxy-2-(2-phenylethylamino)ethyl]-2,3,5,6-tetrahydroxyphenyl]acetamide (PubChem CID 91338886) has the molecular formula C21H24N4O7S and a molecular weight of 476.51 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-4-yl)-N-[4-[1,1-dihydroxy-2-(2-phenylethylamino)ethyl]-2,3,5,6-tetrahydroxyphenyl]acetamide.
| Compound Name | 2-(2-amino-1,3-thiazol-4-yl)-N-[4-[1,1-dihydroxy-2-(2-phenylethylamino)ethyl]-2,3,5,6-tetrahydroxyphenyl]acetamide |
|---|---|
| PubChem CID | 91338886 |
| Molecular Formula | C21H24N4O7S |
| Molecular Weight | 476.51 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-4-yl)-N-[4-[1,1-dihydroxy-2-(2-phenylethylamino)ethyl]-2,3,5,6-tetrahydroxyphenyl]acetamide |
| SMILES | Nc1nc(CC(=O)Nc2c(O)c(O)c(C(O)(O)CNCCc3ccccc3)c(O)c2O)cs1 |
| InChI | InChI=1S/C21H24N4O7S/c22-20-24-12(9-33-20)8-13(26)25-15-18(29)16(27)14(17(28)19(15)30)21(31,32)10-23-7-6-11-4-2-1-3-5-11/h1-5,9,23,27-32H,6-8,10H2,(H2,22,24)(H,25,26) |
| InChIKey | MFVONUPPPJUYGO-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 201.42 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.51 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|