C16H21N3O4S — CID 55501821
3-(carbamoylamino)-N-[3-(furan-2-ylmethoxy)propyl]-3-thiophen-2-ylpropanamide (PubChem CID 55501821) has the molecular formula C16H21N3O4S and a molecular weight of 351.43 g/mol. Its IUPAC name is 3-(carbamoylamino)-N-[3-(furan-2-ylmethoxy)propyl]-3-thiophen-2-ylpropanamide.
| Compound Name | 3-(carbamoylamino)-N-[3-(furan-2-ylmethoxy)propyl]-3-thiophen-2-ylpropanamide |
|---|---|
| PubChem CID | 55501821 |
| Molecular Formula | C16H21N3O4S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 3-(carbamoylamino)-N-[3-(furan-2-ylmethoxy)propyl]-3-thiophen-2-ylpropanamide |
| SMILES | NC(=O)NC(CC(=O)NCCCOCc1ccco1)c1cccs1 |
| InChI | InChI=1S/C16H21N3O4S/c17-16(21)19-13(14-5-2-9-24-14)10-15(20)18-6-3-7-22-11-12-4-1-8-23-12/h1-2,4-5,8-9,13H,3,6-7,10-11H2,(H,18,20)(H3,17,19,21) |
| InChIKey | DLYAGAHWKLWMSM-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 106.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|