C19H27N5O3 — CID 75451642
3-(5-cyclopropyl-1H-1,2,4-triazol-3-yl)-N-[3-(furan-2-ylmethoxy)propyl]piperidine-1-carboxamide (PubChem CID 75451642) has the molecular formula C19H27N5O3 and a molecular weight of 373.46 g/mol. Its IUPAC name is 3-(5-cyclopropyl-1H-1,2,4-triazol-3-yl)-N-[3-(furan-2-ylmethoxy)propyl]piperidine-1-carboxamide.
| Compound Name | 3-(5-cyclopropyl-1H-1,2,4-triazol-3-yl)-N-[3-(furan-2-ylmethoxy)propyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 75451642 |
| Molecular Formula | C19H27N5O3 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.21 |
| IUPAC Name | 3-(5-cyclopropyl-1H-1,2,4-triazol-3-yl)-N-[3-(furan-2-ylmethoxy)propyl]piperidine-1-carboxamide |
| SMILES | O=C(NCCCOCc1ccco1)N1CCCC(c2n[nH]c(C3CC3)n2)C1 |
| InChI | InChI=1S/C19H27N5O3/c25-19(20-8-3-10-26-13-16-5-2-11-27-16)24-9-1-4-15(12-24)18-21-17(22-23-18)14-6-7-14/h2,5,11,14-15H,1,3-4,6-10,12-13H2,(H,20,25)(H,21,22,23) |
| InChIKey | VAFLIWBTVZWUMV-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 96.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|