C18H23N3O3 — CID 94041255
(2R)-N-[3-(furan-2-ylmethoxy)propyl]-2-pyridin-4-ylpyrrolidine-1-carboxamide (PubChem CID 94041255) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is (2R)-N-[3-(furan-2-ylmethoxy)propyl]-2-pyridin-4-ylpyrrolidine-1-carboxamide.
| Compound Name | (2R)-N-[3-(furan-2-ylmethoxy)propyl]-2-pyridin-4-ylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 94041255 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | (2R)-N-[3-(furan-2-ylmethoxy)propyl]-2-pyridin-4-ylpyrrolidine-1-carboxamide |
| SMILES | O=C(NCCCOCc1ccco1)N1CCC[C@@H]1c1ccncc1 |
| InChI | InChI=1S/C18H23N3O3/c22-18(20-8-3-12-23-14-16-4-2-13-24-16)21-11-1-5-17(21)15-6-9-19-10-7-15/h2,4,6-7,9-10,13,17H,1,3,5,8,11-12,14H2,(H,20,22)/t17-/m1/s1 |
| InChIKey | NKLFYHWDUPPYRU-QGZVFWFLSA-N |
| XLogP | 3.13 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|