C21H27N3O3 — CID 52521085
(2S)-N-[3-(3,4-dimethoxyphenyl)propyl]-2-pyridin-4-ylpyrrolidine-1-carboxamide (PubChem CID 52521085) has the molecular formula C21H27N3O3 and a molecular weight of 369.47 g/mol. Its IUPAC name is (2S)-N-[3-(3,4-dimethoxyphenyl)propyl]-2-pyridin-4-ylpyrrolidine-1-carboxamide.
| Compound Name | (2S)-N-[3-(3,4-dimethoxyphenyl)propyl]-2-pyridin-4-ylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 52521085 |
| Molecular Formula | C21H27N3O3 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | (2S)-N-[3-(3,4-dimethoxyphenyl)propyl]-2-pyridin-4-ylpyrrolidine-1-carboxamide |
| SMILES | COc1ccc(CCCNC(=O)N2CCC[C@H]2c2ccncc2)cc1OC |
| InChI | InChI=1S/C21H27N3O3/c1-26-19-8-7-16(15-20(19)27-2)5-3-11-23-21(25)24-14-4-6-18(24)17-9-12-22-13-10-17/h7-10,12-13,15,18H,3-6,11,14H2,1-2H3,(H,23,25)/t18-/m0/s1 |
| InChIKey | MNLZJPXYIHBLPR-SFHVURJKSA-N |
| XLogP | 3.58 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|