C16H20N6O — CID 51084887
2-pyridin-4-yl-N-[2-(pyrimidin-2-ylamino)ethyl]pyrrolidine-1-carboxamide (PubChem CID 51084887) has the molecular formula C16H20N6O and a molecular weight of 312.38 g/mol. Its IUPAC name is 2-pyridin-4-yl-N-[2-(pyrimidin-2-ylamino)ethyl]pyrrolidine-1-carboxamide.
| Compound Name | 2-pyridin-4-yl-N-[2-(pyrimidin-2-ylamino)ethyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 51084887 |
| Molecular Formula | C16H20N6O |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 2-pyridin-4-yl-N-[2-(pyrimidin-2-ylamino)ethyl]pyrrolidine-1-carboxamide |
| SMILES | O=C(NCCNc1ncccn1)N1CCCC1c1ccncc1 |
| InChI | InChI=1S/C16H20N6O/c23-16(21-11-10-20-15-18-6-2-7-19-15)22-12-1-3-14(22)13-4-8-17-9-5-13/h2,4-9,14H,1,3,10-12H2,(H,21,23)(H,18,19,20) |
| InChIKey | PVBDQOKJDFHIEH-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|