C14H24N2O2 — CID 28681139
N-[3-(furan-2-ylmethoxy)propyl]-1-methylpiperidin-4-amine (PubChem CID 28681139) has the molecular formula C14H24N2O2 and a molecular weight of 252.36 g/mol. Its IUPAC name is N-[3-(furan-2-ylmethoxy)propyl]-1-methylpiperidin-4-amine.
| Compound Name | N-[3-(furan-2-ylmethoxy)propyl]-1-methylpiperidin-4-amine |
|---|---|
| PubChem CID | 28681139 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | N-[3-(furan-2-ylmethoxy)propyl]-1-methylpiperidin-4-amine |
| SMILES | CN1CCC(NCCCOCc2ccco2)CC1 |
| InChI | InChI=1S/C14H24N2O2/c1-16-8-5-13(6-9-16)15-7-3-10-17-12-14-4-2-11-18-14/h2,4,11,13,15H,3,5-10,12H2,1H3 |
| InChIKey | AJCNTUAVXYTTDO-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 37.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|