C15H25NO2S — CID 79956139
N-[3-(furan-2-ylmethoxy)propyl]-5,5-dimethylthian-3-amine (PubChem CID 79956139) has the molecular formula C15H25NO2S and a molecular weight of 283.44 g/mol. Its IUPAC name is N-[3-(furan-2-ylmethoxy)propyl]-5,5-dimethylthian-3-amine.
| Compound Name | N-[3-(furan-2-ylmethoxy)propyl]-5,5-dimethylthian-3-amine |
|---|---|
| PubChem CID | 79956139 |
| Molecular Formula | C15H25NO2S |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | N-[3-(furan-2-ylmethoxy)propyl]-5,5-dimethylthian-3-amine |
| SMILES | CC1(C)CSCC(NCCCOCc2ccco2)C1 |
| InChI | InChI=1S/C15H25NO2S/c1-15(2)9-13(11-19-12-15)16-6-4-7-17-10-14-5-3-8-18-14/h3,5,8,13,16H,4,6-7,9-12H2,1-2H3 |
| InChIKey | JBHYLFRTWWGIFU-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|