C17H20ClNO2 — CID 81296849
5-chloro-N-[3-(furan-2-ylmethoxy)propyl]-2,3-dihydro-1H-inden-1-amine (PubChem CID 81296849) has the molecular formula C17H20ClNO2 and a molecular weight of 305.81 g/mol. Its IUPAC name is 5-chloro-N-[3-(furan-2-ylmethoxy)propyl]-2,3-dihydro-1H-inden-1-amine.
| Compound Name | 5-chloro-N-[3-(furan-2-ylmethoxy)propyl]-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 81296849 |
| Molecular Formula | C17H20ClNO2 |
| Molecular Weight | 305.81 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 5-chloro-N-[3-(furan-2-ylmethoxy)propyl]-2,3-dihydro-1H-inden-1-amine |
| SMILES | Clc1ccc2c(c1)CCC2NCCCOCc1ccco1 |
| InChI | InChI=1S/C17H20ClNO2/c18-14-5-6-16-13(11-14)4-7-17(16)19-8-2-9-20-12-15-3-1-10-21-15/h1,3,5-6,10-11,17,19H,2,4,7-9,12H2 |
| InChIKey | HRWOPTQFJJNXQK-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.81 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|