C15H13Cl3N2OS — CID 6975463
(4S)-4-methyl-N-(2,3,4-trichlorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxamide (PubChem CID 6975463) has the molecular formula C15H13Cl3N2OS and a molecular weight of 375.71 g/mol. Its IUPAC name is (4S)-4-methyl-N-(2,3,4-trichlorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxamide.
| Compound Name | (4S)-4-methyl-N-(2,3,4-trichlorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 6975463 |
| Molecular Formula | C15H13Cl3N2OS |
| Molecular Weight | 375.71 g/mol |
| Exact Mass | 373.98 |
| IUPAC Name | (4S)-4-methyl-N-(2,3,4-trichlorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxamide |
| SMILES | C[C@H]1c2ccsc2CCN1C(=O)Nc1ccc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C15H13Cl3N2OS/c1-8-9-5-7-22-12(9)4-6-20(8)15(21)19-11-3-2-10(16)13(17)14(11)18/h2-3,5,7-8H,4,6H2,1H3,(H,19,21)/t8-/m0/s1 |
| InChIKey | NSVNPHVUMMDNDD-QMMMGPOBSA-N |
| XLogP | 5.86 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.71 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|