C24H33N3O3S — CID 4991293
1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(3-methoxyphenyl)-1-(1-methylpiperidin-4-yl)thiourea (PubChem CID 4991293) has the molecular formula C24H33N3O3S and a molecular weight of 443.61 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(3-methoxyphenyl)-1-(1-methylpiperidin-4-yl)thiourea.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(3-methoxyphenyl)-1-(1-methylpiperidin-4-yl)thiourea |
|---|---|
| PubChem CID | 4991293 |
| Molecular Formula | C24H33N3O3S |
| Molecular Weight | 443.61 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(3-methoxyphenyl)-1-(1-methylpiperidin-4-yl)thiourea |
| SMILES | COc1cccc(NC(=S)N(CCc2ccc(OC)c(OC)c2)C2CCN(C)CC2)c1 |
| InChI | InChI=1S/C24H33N3O3S/c1-26-13-11-20(12-14-26)27(24(31)25-19-6-5-7-21(17-19)28-2)15-10-18-8-9-22(29-3)23(16-18)30-4/h5-9,16-17,20H,10-15H2,1-4H3,(H,25,31) |
| InChIKey | KUPRNEPIYYCUDZ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 46.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.61 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|