C17H15Cl2FN2O2 — CID 110625415
N-[2-(3-chloro-4-fluoroanilino)-2-oxoethyl]-3-(3-chlorophenyl)propanamide (PubChem CID 110625415) has the molecular formula C17H15Cl2FN2O2 and a molecular weight of 369.22 g/mol. Its IUPAC name is N-[2-(3-chloro-4-fluoroanilino)-2-oxoethyl]-3-(3-chlorophenyl)propanamide.
| Compound Name | N-[2-(3-chloro-4-fluoroanilino)-2-oxoethyl]-3-(3-chlorophenyl)propanamide |
|---|---|
| PubChem CID | 110625415 |
| Molecular Formula | C17H15Cl2FN2O2 |
| Molecular Weight | 369.22 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | N-[2-(3-chloro-4-fluoroanilino)-2-oxoethyl]-3-(3-chlorophenyl)propanamide |
| SMILES | O=C(CCc1cccc(Cl)c1)NCC(=O)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C17H15Cl2FN2O2/c18-12-3-1-2-11(8-12)4-7-16(23)21-10-17(24)22-13-5-6-15(20)14(19)9-13/h1-3,5-6,8-9H,4,7,10H2,(H,21,23)(H,22,24) |
| InChIKey | PKAHCDQUVXRYRN-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.22 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |