C17H17Cl2N3OS — CID 8683535
N-(2,5-dichlorophenyl)-2-[(3,4-dimethylphenyl)carbamothioylamino]acetamide (PubChem CID 8683535) has the molecular formula C17H17Cl2N3OS and a molecular weight of 382.32 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-2-[(3,4-dimethylphenyl)carbamothioylamino]acetamide.
| Compound Name | N-(2,5-dichlorophenyl)-2-[(3,4-dimethylphenyl)carbamothioylamino]acetamide |
|---|---|
| PubChem CID | 8683535 |
| Molecular Formula | C17H17Cl2N3OS |
| Molecular Weight | 382.32 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | N-(2,5-dichlorophenyl)-2-[(3,4-dimethylphenyl)carbamothioylamino]acetamide |
| SMILES | Cc1ccc(NC(=S)NCC(=O)Nc2cc(Cl)ccc2Cl)cc1C |
| InChI | InChI=1S/C17H17Cl2N3OS/c1-10-3-5-13(7-11(10)2)21-17(24)20-9-16(23)22-15-8-12(18)4-6-14(15)19/h3-8H,9H2,1-2H3,(H,22,23)(H2,20,21,24) |
| InChIKey | PKDYSSDWBVXPBU-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.32 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|