C14H18ClFN2O2S — CID 3863219
pentyl 2-[(3-chloro-4-fluorophenyl)carbamothioylamino]acetate (PubChem CID 3863219) has the molecular formula C14H18ClFN2O2S and a molecular weight of 332.83 g/mol. Its IUPAC name is pentyl 2-[(3-chloro-4-fluorophenyl)carbamothioylamino]acetate.
| Compound Name | pentyl 2-[(3-chloro-4-fluorophenyl)carbamothioylamino]acetate |
|---|---|
| PubChem CID | 3863219 |
| Molecular Formula | C14H18ClFN2O2S |
| Molecular Weight | 332.83 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | pentyl 2-[(3-chloro-4-fluorophenyl)carbamothioylamino]acetate |
| SMILES | CCCCCOC(=O)CNC(=S)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C14H18ClFN2O2S/c1-2-3-4-7-20-13(19)9-17-14(21)18-10-5-6-12(16)11(15)8-10/h5-6,8H,2-4,7,9H2,1H3,(H2,17,18,21) |
| InChIKey | ISHOWDWCMCKGGW-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.83 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|