C13H17ClFN3OS — CID 9095750
(2S)-2-[(3-chloro-4-fluorophenyl)carbamothioylamino]-N-propylpropanamide (PubChem CID 9095750) has the molecular formula C13H17ClFN3OS and a molecular weight of 317.82 g/mol. Its IUPAC name is (2S)-2-[(3-chloro-4-fluorophenyl)carbamothioylamino]-N-propylpropanamide.
| Compound Name | (2S)-2-[(3-chloro-4-fluorophenyl)carbamothioylamino]-N-propylpropanamide |
|---|---|
| PubChem CID | 9095750 |
| Molecular Formula | C13H17ClFN3OS |
| Molecular Weight | 317.82 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | (2S)-2-[(3-chloro-4-fluorophenyl)carbamothioylamino]-N-propylpropanamide |
| SMILES | CCCNC(=O)[C@H](C)NC(=S)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C13H17ClFN3OS/c1-3-6-16-12(19)8(2)17-13(20)18-9-4-5-11(15)10(14)7-9/h4-5,7-8H,3,6H2,1-2H3,(H,16,19)(H2,17,18,20)/t8-/m0/s1 |
| InChIKey | DWFYZUFKLVGHGV-QMMMGPOBSA-N |
| XLogP | 2.68 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.82 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|