C19H21ClFN4O3+ — CID 7774728
(2S)-N-(2-chloro-4-nitrophenyl)-2-[4-(2-fluorophenyl)piperazin-1-ium-1-yl]propanamide (PubChem CID 7774728) has the molecular formula C19H21ClFN4O3+ and a molecular weight of 407.85 g/mol. Its IUPAC name is (2S)-N-(2-chloro-4-nitrophenyl)-2-[4-(2-fluorophenyl)piperazin-1-ium-1-yl]propanamide.
| Compound Name | (2S)-N-(2-chloro-4-nitrophenyl)-2-[4-(2-fluorophenyl)piperazin-1-ium-1-yl]propanamide |
|---|---|
| PubChem CID | 7774728 |
| Molecular Formula | C19H21ClFN4O3+ |
| Molecular Weight | 407.85 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | (2S)-N-(2-chloro-4-nitrophenyl)-2-[4-(2-fluorophenyl)piperazin-1-ium-1-yl]propanamide |
| SMILES | C[C@@H](C(=O)Nc1ccc([N+](=O)[O-])cc1Cl)[NH+]1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C19H20ClFN4O3/c1-13(19(26)22-17-7-6-14(25(27)28)12-15(17)20)23-8-10-24(11-9-23)18-5-3-2-4-16(18)21/h2-7,12-13H,8-11H2,1H3,(H,22,26)/p+1/t13-/m0/s1 |
| InChIKey | BCPKDNHGDSTMGR-ZDUSSCGKSA-O |
| XLogP | 2.12 |
| TPSA | 79.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.85 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|