C16H24ClN3O2 — CID 83284147
2-[4-(4-chlorophenyl)piperazin-1-yl]-N-(2-methoxyethyl)propanamide (PubChem CID 83284147) has the molecular formula C16H24ClN3O2 and a molecular weight of 325.84 g/mol. Its IUPAC name is 2-[4-(4-chlorophenyl)piperazin-1-yl]-N-(2-methoxyethyl)propanamide.
| Compound Name | 2-[4-(4-chlorophenyl)piperazin-1-yl]-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 83284147 |
| Molecular Formula | C16H24ClN3O2 |
| Molecular Weight | 325.84 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | 2-[4-(4-chlorophenyl)piperazin-1-yl]-N-(2-methoxyethyl)propanamide |
| SMILES | COCCNC(=O)C(C)N1CCN(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C16H24ClN3O2/c1-13(16(21)18-7-12-22-2)19-8-10-20(11-9-19)15-5-3-14(17)4-6-15/h3-6,13H,7-12H2,1-2H3,(H,18,21) |
| InChIKey | TUXBMUUAZOZOMF-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.84 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|