C18H28ClN5O2 — CID 111186907
2-[[[4-(3-chlorophenyl)piperazin-1-yl]-(ethylamino)methylidene]amino]-N-(2-methoxyethyl)acetamide (PubChem CID 111186907) has the molecular formula C18H28ClN5O2 and a molecular weight of 381.91 g/mol. Its IUPAC name is 2-[[[4-(3-chlorophenyl)piperazin-1-yl]-(ethylamino)methylidene]amino]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[[[4-(3-chlorophenyl)piperazin-1-yl]-(ethylamino)methylidene]amino]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 111186907 |
| Molecular Formula | C18H28ClN5O2 |
| Molecular Weight | 381.91 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | 2-[[[4-(3-chlorophenyl)piperazin-1-yl]-(ethylamino)methylidene]amino]-N-(2-methoxyethyl)acetamide |
| SMILES | CCN/C(=N\CC(=O)NCCOC)N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C18H28ClN5O2/c1-3-20-18(22-14-17(25)21-7-12-26-2)24-10-8-23(9-11-24)16-6-4-5-15(19)13-16/h4-6,13H,3,7-12,14H2,1-2H3,(H,20,22)(H,21,25) |
| InChIKey | WREDRLJTKHVCNR-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.91 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|