C19H30ClN5O — CID 111186611
N-tert-butyl-2-[[[4-(3-chlorophenyl)piperazin-1-yl]-(ethylamino)methylidene]amino]acetamide (PubChem CID 111186611) has the molecular formula C19H30ClN5O and a molecular weight of 379.94 g/mol. Its IUPAC name is N-tert-butyl-2-[[[4-(3-chlorophenyl)piperazin-1-yl]-(ethylamino)methylidene]amino]acetamide.
| Compound Name | N-tert-butyl-2-[[[4-(3-chlorophenyl)piperazin-1-yl]-(ethylamino)methylidene]amino]acetamide |
|---|---|
| PubChem CID | 111186611 |
| Molecular Formula | C19H30ClN5O |
| Molecular Weight | 379.94 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | N-tert-butyl-2-[[[4-(3-chlorophenyl)piperazin-1-yl]-(ethylamino)methylidene]amino]acetamide |
| SMILES | CCN/C(=N\CC(=O)NC(C)(C)C)N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C19H30ClN5O/c1-5-21-18(22-14-17(26)23-19(2,3)4)25-11-9-24(10-12-25)16-8-6-7-15(20)13-16/h6-8,13H,5,9-12,14H2,1-4H3,(H,21,22)(H,23,26) |
| InChIKey | QEQJEGIDDBSEKU-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.94 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|