C21H33ClN6O2 — CID 111385906
N-tert-butyl-2-[[[[2-[4-(4-chlorophenyl)piperazin-1-yl]-2-oxoethyl]amino]-(ethylamino)methylidene]amino]acetamide (PubChem CID 111385906) has the molecular formula C21H33ClN6O2 and a molecular weight of 436.99 g/mol. Its IUPAC name is N-tert-butyl-2-[[[[2-[4-(4-chlorophenyl)piperazin-1-yl]-2-oxoethyl]amino]-(ethylamino)methylidene]amino]acetamide.
| Compound Name | N-tert-butyl-2-[[[[2-[4-(4-chlorophenyl)piperazin-1-yl]-2-oxoethyl]amino]-(ethylamino)methylidene]amino]acetamide |
|---|---|
| PubChem CID | 111385906 |
| Molecular Formula | C21H33ClN6O2 |
| Molecular Weight | 436.99 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | N-tert-butyl-2-[[[[2-[4-(4-chlorophenyl)piperazin-1-yl]-2-oxoethyl]amino]-(ethylamino)methylidene]amino]acetamide |
| SMILES | CCN/C(=N\CC(=O)NC(C)(C)C)NCC(=O)N1CCN(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C21H33ClN6O2/c1-5-23-20(24-14-18(29)26-21(2,3)4)25-15-19(30)28-12-10-27(11-13-28)17-8-6-16(22)7-9-17/h6-9H,5,10-15H2,1-4H3,(H,26,29)(H2,23,24,25) |
| InChIKey | BFUBOHFHQYBMJG-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.99 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|