C18H24ClN5O — CID 111850096
2-[2-[4-(4-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-1-ethyl-3-prop-2-ynylguanidine (PubChem CID 111850096) has the molecular formula C18H24ClN5O and a molecular weight of 361.88 g/mol. Its IUPAC name is 2-[2-[4-(4-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-1-ethyl-3-prop-2-ynylguanidine.
| Compound Name | 2-[2-[4-(4-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-1-ethyl-3-prop-2-ynylguanidine |
|---|---|
| PubChem CID | 111850096 |
| Molecular Formula | C18H24ClN5O |
| Molecular Weight | 361.88 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | 2-[2-[4-(4-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-1-ethyl-3-prop-2-ynylguanidine |
| SMILES | C#CCN/C(=N/CC(=O)N1CCN(c2ccc(Cl)cc2)CC1)NCC |
| InChI | InChI=1S/C18H24ClN5O/c1-3-9-21-18(20-4-2)22-14-17(25)24-12-10-23(11-13-24)16-7-5-15(19)6-8-16/h1,5-8H,4,9-14H2,2H3,(H2,20,21,22) |
| InChIKey | RGWDWYNEKOGWIX-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.88 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|