C20H33ClIN5OS — CID 111627877
2-[2-[4-(4-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-1-ethyl-3-(4-methylsulfanylbutyl)guanidine;hydroiodide (PubChem CID 111627877) has the molecular formula C20H33ClIN5OS and a molecular weight of 553.94 g/mol. Its IUPAC name is 2-[2-[4-(4-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-1-ethyl-3-(4-methylsulfanylbutyl)guanidine;hydroiodide.
| Compound Name | 2-[2-[4-(4-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-1-ethyl-3-(4-methylsulfanylbutyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111627877 |
| Molecular Formula | C20H33ClIN5OS |
| Molecular Weight | 553.94 g/mol |
| Exact Mass | 553.11 |
| IUPAC Name | 2-[2-[4-(4-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-1-ethyl-3-(4-methylsulfanylbutyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)N1CCN(c2ccc(Cl)cc2)CC1)NCCCCSC.I |
| InChI | InChI=1S/C20H32ClN5OS.HI/c1-3-22-20(23-10-4-5-15-28-2)24-16-19(27)26-13-11-25(12-14-26)18-8-6-17(21)7-9-18;/h6-9H,3-5,10-16H2,1-2H3,(H2,22,23,24);1H |
| InChIKey | ITMKSVCXRPXOQE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.94 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|