C16H22Cl2N3O3S+ — CID 9493299
(2S)-2-[4-(3,4-dichlorophenyl)sulfonylpiperazin-1-ium-1-yl]-N-prop-2-enylpropanamide (PubChem CID 9493299) has the molecular formula C16H22Cl2N3O3S+ and a molecular weight of 407.34 g/mol. Its IUPAC name is (2S)-2-[4-(3,4-dichlorophenyl)sulfonylpiperazin-1-ium-1-yl]-N-prop-2-enylpropanamide.
| Compound Name | (2S)-2-[4-(3,4-dichlorophenyl)sulfonylpiperazin-1-ium-1-yl]-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 9493299 |
| Molecular Formula | C16H22Cl2N3O3S+ |
| Molecular Weight | 407.34 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | (2S)-2-[4-(3,4-dichlorophenyl)sulfonylpiperazin-1-ium-1-yl]-N-prop-2-enylpropanamide |
| SMILES | C=CCNC(=O)[C@H](C)[NH+]1CCN(S(=O)(=O)c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C16H21Cl2N3O3S/c1-3-6-19-16(22)12(2)20-7-9-21(10-8-20)25(23,24)13-4-5-14(17)15(18)11-13/h3-5,11-12H,1,6-10H2,2H3,(H,19,22)/p+1/t12-/m0/s1 |
| InChIKey | JJHXVFWVYKBVPB-LBPRGKRZSA-O |
| XLogP | 0.57 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.34 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|