C18H22F2N2O5S — CID 46624752
[1-oxo-1-(prop-2-enylamino)propan-2-yl] 1-(3,4-difluorophenyl)sulfonylpiperidine-4-carboxylate (PubChem CID 46624752) has the molecular formula C18H22F2N2O5S and a molecular weight of 416.45 g/mol. Its IUPAC name is [1-oxo-1-(prop-2-enylamino)propan-2-yl] 1-(3,4-difluorophenyl)sulfonylpiperidine-4-carboxylate.
| Compound Name | [1-oxo-1-(prop-2-enylamino)propan-2-yl] 1-(3,4-difluorophenyl)sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 46624752 |
| Molecular Formula | C18H22F2N2O5S |
| Molecular Weight | 416.45 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | [1-oxo-1-(prop-2-enylamino)propan-2-yl] 1-(3,4-difluorophenyl)sulfonylpiperidine-4-carboxylate |
| SMILES | C=CCNC(=O)C(C)OC(=O)C1CCN(S(=O)(=O)c2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C18H22F2N2O5S/c1-3-8-21-17(23)12(2)27-18(24)13-6-9-22(10-7-13)28(25,26)14-4-5-15(19)16(20)11-14/h3-5,11-13H,1,6-10H2,2H3,(H,21,23) |
| InChIKey | PFGNJWNXKWHTKM-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.45 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|