C18H23FN2O5S — CID 8940241
[(2R)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 1-(4-fluorophenyl)sulfonylpiperidine-4-carboxylate (PubChem CID 8940241) has the molecular formula C18H23FN2O5S and a molecular weight of 398.46 g/mol. Its IUPAC name is [(2R)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 1-(4-fluorophenyl)sulfonylpiperidine-4-carboxylate.
| Compound Name | [(2R)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 1-(4-fluorophenyl)sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 8940241 |
| Molecular Formula | C18H23FN2O5S |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | [(2R)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 1-(4-fluorophenyl)sulfonylpiperidine-4-carboxylate |
| SMILES | C=CCNC(=O)[C@@H](C)OC(=O)C1CCN(S(=O)(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C18H23FN2O5S/c1-3-10-20-17(22)13(2)26-18(23)14-8-11-21(12-9-14)27(24,25)16-6-4-15(19)5-7-16/h3-7,13-14H,1,8-12H2,2H3,(H,20,22)/t13-/m1/s1 |
| InChIKey | GXEWYODJILMQTI-CYBMUJFWSA-N |
| XLogP | 1.46 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|