C13H18N2O5S2 — CID 46646799
[1-oxo-1-(prop-2-enylamino)propan-2-yl] 3-(thiophen-2-ylsulfonylamino)propanoate (PubChem CID 46646799) has the molecular formula C13H18N2O5S2 and a molecular weight of 346.43 g/mol. Its IUPAC name is [1-oxo-1-(prop-2-enylamino)propan-2-yl] 3-(thiophen-2-ylsulfonylamino)propanoate.
| Compound Name | [1-oxo-1-(prop-2-enylamino)propan-2-yl] 3-(thiophen-2-ylsulfonylamino)propanoate |
|---|---|
| PubChem CID | 46646799 |
| Molecular Formula | C13H18N2O5S2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | [1-oxo-1-(prop-2-enylamino)propan-2-yl] 3-(thiophen-2-ylsulfonylamino)propanoate |
| SMILES | C=CCNC(=O)C(C)OC(=O)CCNS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C13H18N2O5S2/c1-3-7-14-13(17)10(2)20-11(16)6-8-15-22(18,19)12-5-4-9-21-12/h3-5,9-10,15H,1,6-8H2,2H3,(H,14,17) |
| InChIKey | OVYRWMPIFJPBHH-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|