C16H17ClN2O5S2 — CID 7836890
[(2R)-1-(3-chloroanilino)-1-oxopropan-2-yl] 3-(thiophen-2-ylsulfonylamino)propanoate (PubChem CID 7836890) has the molecular formula C16H17ClN2O5S2 and a molecular weight of 416.91 g/mol. Its IUPAC name is [(2R)-1-(3-chloroanilino)-1-oxopropan-2-yl] 3-(thiophen-2-ylsulfonylamino)propanoate.
| Compound Name | [(2R)-1-(3-chloroanilino)-1-oxopropan-2-yl] 3-(thiophen-2-ylsulfonylamino)propanoate |
|---|---|
| PubChem CID | 7836890 |
| Molecular Formula | C16H17ClN2O5S2 |
| Molecular Weight | 416.91 g/mol |
| Exact Mass | 416.03 |
| IUPAC Name | [(2R)-1-(3-chloroanilino)-1-oxopropan-2-yl] 3-(thiophen-2-ylsulfonylamino)propanoate |
| SMILES | C[C@@H](OC(=O)CCNS(=O)(=O)c1cccs1)C(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C16H17ClN2O5S2/c1-11(16(21)19-13-5-2-4-12(17)10-13)24-14(20)7-8-18-26(22,23)15-6-3-9-25-15/h2-6,9-11,18H,7-8H2,1H3,(H,19,21)/t11-/m1/s1 |
| InChIKey | RRKMJUWOFXMUIX-LLVKDONJSA-N |
| XLogP | 2.64 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.91 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |