C17H26N2O5S2 — CID 24671323
[1-[cyclohexyl(methyl)amino]-1-oxopropan-2-yl] 3-(thiophen-2-ylsulfonylamino)propanoate (PubChem CID 24671323) has the molecular formula C17H26N2O5S2 and a molecular weight of 402.54 g/mol. Its IUPAC name is [1-[cyclohexyl(methyl)amino]-1-oxopropan-2-yl] 3-(thiophen-2-ylsulfonylamino)propanoate.
| Compound Name | [1-[cyclohexyl(methyl)amino]-1-oxopropan-2-yl] 3-(thiophen-2-ylsulfonylamino)propanoate |
|---|---|
| PubChem CID | 24671323 |
| Molecular Formula | C17H26N2O5S2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | [1-[cyclohexyl(methyl)amino]-1-oxopropan-2-yl] 3-(thiophen-2-ylsulfonylamino)propanoate |
| SMILES | CC(OC(=O)CCNS(=O)(=O)c1cccs1)C(=O)N(C)C1CCCCC1 |
| InChI | InChI=1S/C17H26N2O5S2/c1-13(17(21)19(2)14-7-4-3-5-8-14)24-15(20)10-11-18-26(22,23)16-9-6-12-25-16/h6,9,12-14,18H,3-5,7-8,10-11H2,1-2H3 |
| InChIKey | PUHDYFZZOXEJDQ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |