C18H19ClN2O5 — CID 108540157
N-[2-[3-(4-chlorophenyl)propanoylamino]ethyl]-3,4,5-trihydroxybenzamide (PubChem CID 108540157) has the molecular formula C18H19ClN2O5 and a molecular weight of 378.81 g/mol. Its IUPAC name is N-[2-[3-(4-chlorophenyl)propanoylamino]ethyl]-3,4,5-trihydroxybenzamide.
| Compound Name | N-[2-[3-(4-chlorophenyl)propanoylamino]ethyl]-3,4,5-trihydroxybenzamide |
|---|---|
| PubChem CID | 108540157 |
| Molecular Formula | C18H19ClN2O5 |
| Molecular Weight | 378.81 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | N-[2-[3-(4-chlorophenyl)propanoylamino]ethyl]-3,4,5-trihydroxybenzamide |
| SMILES | O=C(CCc1ccc(Cl)cc1)NCCNC(=O)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C18H19ClN2O5/c19-13-4-1-11(2-5-13)3-6-16(24)20-7-8-21-18(26)12-9-14(22)17(25)15(23)10-12/h1-2,4-5,9-10,22-23,25H,3,6-8H2,(H,20,24)(H,21,26) |
| InChIKey | AVGUXHSVMSVORI-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 118.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.81 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|