C10H14N2O2 — CID 177134312
2-cyano-N-[2-(3-methylbuta-1,3-dien-2-yloxy)ethyl]acetamide (PubChem CID 177134312) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is 2-cyano-N-[2-(3-methylbuta-1,3-dien-2-yloxy)ethyl]acetamide.
| Compound Name | 2-cyano-N-[2-(3-methylbuta-1,3-dien-2-yloxy)ethyl]acetamide |
|---|---|
| PubChem CID | 177134312 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 2-cyano-N-[2-(3-methylbuta-1,3-dien-2-yloxy)ethyl]acetamide |
| SMILES | C=C(C)C(=C)OCCNC(=O)CC#N |
| InChI | InChI=1S/C10H14N2O2/c1-8(2)9(3)14-7-6-12-10(13)4-5-11/h1,3-4,6-7H2,2H3,(H,12,13) |
| InChIKey | FABXRMVKQUNLBD-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|