C18H26N2O5Se — CID 102311879
methyl (2S)-2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylselanylpropanoyl]amino]propanoate (PubChem CID 102311879) has the molecular formula C18H26N2O5Se and a molecular weight of 429.38 g/mol. Its IUPAC name is methyl (2S)-2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylselanylpropanoyl]amino]propanoate.
| Compound Name | methyl (2S)-2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylselanylpropanoyl]amino]propanoate |
|---|---|
| PubChem CID | 102311879 |
| Molecular Formula | C18H26N2O5Se |
| Molecular Weight | 429.38 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | methyl (2S)-2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylselanylpropanoyl]amino]propanoate |
| SMILES | COC(=O)[C@H](C)NC(=O)[C@H](C[Se]c1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H26N2O5Se/c1-12(16(22)24-5)19-15(21)14(20-17(23)25-18(2,3)4)11-26-13-9-7-6-8-10-13/h6-10,12,14H,11H2,1-5H3,(H,19,21)(H,20,23)/t12-,14-/m0/s1 |
| InChIKey | PFEBSFDDEJUFSW-JSGCOSHPSA-N |
| XLogP | 1.01 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.38 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|