C15H26N2O5 — CID 91201222
cyclopropyl 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoylamino]propanoate (PubChem CID 91201222) has the molecular formula C15H26N2O5 and a molecular weight of 314.38 g/mol. Its IUPAC name is cyclopropyl 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoylamino]propanoate.
| Compound Name | cyclopropyl 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoylamino]propanoate |
|---|---|
| PubChem CID | 91201222 |
| Molecular Formula | C15H26N2O5 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | cyclopropyl 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoylamino]propanoate |
| SMILES | CCC(NC(=O)OC(C)(C)C)C(=O)NC(C)C(=O)OC1CC1 |
| InChI | InChI=1S/C15H26N2O5/c1-6-11(17-14(20)22-15(3,4)5)12(18)16-9(2)13(19)21-10-7-8-10/h9-11H,6-8H2,1-5H3,(H,16,18)(H,17,20) |
| InChIKey | WITXZVVNDVHBDN-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |