C25H35FN2O3S — CID 143814300
N-[(2R)-butan-2-yl]-4-[2-fluoro-5-(methylsulfanylamino)phenyl]-3-(3-methoxypropoxy)-N-propan-2-ylbenzamide (PubChem CID 143814300) has the molecular formula C25H35FN2O3S and a molecular weight of 462.63 g/mol. Its IUPAC name is N-[(2R)-butan-2-yl]-4-[2-fluoro-5-(methylsulfanylamino)phenyl]-3-(3-methoxypropoxy)-N-propan-2-ylbenzamide.
| Compound Name | N-[(2R)-butan-2-yl]-4-[2-fluoro-5-(methylsulfanylamino)phenyl]-3-(3-methoxypropoxy)-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 143814300 |
| Molecular Formula | C25H35FN2O3S |
| Molecular Weight | 462.63 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | N-[(2R)-butan-2-yl]-4-[2-fluoro-5-(methylsulfanylamino)phenyl]-3-(3-methoxypropoxy)-N-propan-2-ylbenzamide |
| SMILES | CC[C@@H](C)N(C(=O)c1ccc(-c2cc(NSC)ccc2F)c(OCCCOC)c1)C(C)C |
| InChI | InChI=1S/C25H35FN2O3S/c1-7-18(4)28(17(2)3)25(29)19-9-11-21(24(15-19)31-14-8-13-30-5)22-16-20(27-32-6)10-12-23(22)26/h9-12,15-18,27H,7-8,13-14H2,1-6H3/t18-/m1/s1 |
| InChIKey | ZLIVTPQTMCJWBQ-GOSISDBHSA-N |
| XLogP | 6.25 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.63 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|