C26H45N3O6 — CID 44517740
N-[(2S,3S,5R)-2-amino-6-(butylamino)-3-hydroxy-5-methyl-6-oxohexyl]-4-methoxy-3-(3-methoxypropoxy)-N-propan-2-ylbenzamide (PubChem CID 44517740) has the molecular formula C26H45N3O6 and a molecular weight of 495.66 g/mol. Its IUPAC name is N-[(2S,3S,5R)-2-amino-6-(butylamino)-3-hydroxy-5-methyl-6-oxohexyl]-4-methoxy-3-(3-methoxypropoxy)-N-propan-2-ylbenzamide.
| Compound Name | N-[(2S,3S,5R)-2-amino-6-(butylamino)-3-hydroxy-5-methyl-6-oxohexyl]-4-methoxy-3-(3-methoxypropoxy)-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 44517740 |
| Molecular Formula | C26H45N3O6 |
| Molecular Weight | 495.66 g/mol |
| Exact Mass | 495.33 |
| IUPAC Name | N-[(2S,3S,5R)-2-amino-6-(butylamino)-3-hydroxy-5-methyl-6-oxohexyl]-4-methoxy-3-(3-methoxypropoxy)-N-propan-2-ylbenzamide |
| SMILES | CCCCNC(=O)[C@H](C)C[C@H](O)[C@@H](N)CN(C(=O)c1ccc(OC)c(OCCCOC)c1)C(C)C |
| InChI | InChI=1S/C26H45N3O6/c1-7-8-12-28-25(31)19(4)15-22(30)21(27)17-29(18(2)3)26(32)20-10-11-23(34-6)24(16-20)35-14-9-13-33-5/h10-11,16,18-19,21-22,30H,7-9,12-15,17,27H2,1-6H3,(H,28,31)/t19-,21+,22+/m1/s1 |
| InChIKey | UZTWTKGFIWIYEJ-HJNYFJLDSA-N |
| XLogP | 2.59 |
| TPSA | 123.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.66 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|