C26H44N2O4 — CID 143729554
N-[(2R)-butan-2-yl]-4-(4-methoxybutyl)-2,2-dimethyl-3-oxo-N-propan-2-yl-1,4-benzoxazine-6-carboxamide;propane (PubChem CID 143729554) has the molecular formula C26H44N2O4 and a molecular weight of 448.65 g/mol. Its IUPAC name is N-[(2R)-butan-2-yl]-4-(4-methoxybutyl)-2,2-dimethyl-3-oxo-N-propan-2-yl-1,4-benzoxazine-6-carboxamide;propane.
| Compound Name | N-[(2R)-butan-2-yl]-4-(4-methoxybutyl)-2,2-dimethyl-3-oxo-N-propan-2-yl-1,4-benzoxazine-6-carboxamide;propane |
|---|---|
| PubChem CID | 143729554 |
| Molecular Formula | C26H44N2O4 |
| Molecular Weight | 448.65 g/mol |
| Exact Mass | 448.33 |
| IUPAC Name | N-[(2R)-butan-2-yl]-4-(4-methoxybutyl)-2,2-dimethyl-3-oxo-N-propan-2-yl-1,4-benzoxazine-6-carboxamide;propane |
| SMILES | CCC.CC[C@@H](C)N(C(=O)c1ccc2c(c1)N(CCCCOC)C(=O)C(C)(C)O2)C(C)C |
| InChI | InChI=1S/C23H36N2O4.C3H8/c1-8-17(4)25(16(2)3)21(26)18-11-12-20-19(15-18)24(13-9-10-14-28-7)22(27)23(5,6)29-20;1-3-2/h11-12,15-17H,8-10,13-14H2,1-7H3;3H2,1-2H3/t17-;/m1./s1 |
| InChIKey | XWEPZQWAOYGYBP-UNTBIKODSA-N |
| XLogP | 5.68 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.65 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|