C18H23F2NO5 — CID 58375816
methyl 7-(difluoromethyl)-4-(4-methoxybutyl)-2,2-dimethyl-3-oxo-1,4-benzoxazine-6-carboxylate (PubChem CID 58375816) has the molecular formula C18H23F2NO5 and a molecular weight of 371.38 g/mol. Its IUPAC name is methyl 7-(difluoromethyl)-4-(4-methoxybutyl)-2,2-dimethyl-3-oxo-1,4-benzoxazine-6-carboxylate.
| Compound Name | methyl 7-(difluoromethyl)-4-(4-methoxybutyl)-2,2-dimethyl-3-oxo-1,4-benzoxazine-6-carboxylate |
|---|---|
| PubChem CID | 58375816 |
| Molecular Formula | C18H23F2NO5 |
| Molecular Weight | 371.38 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | methyl 7-(difluoromethyl)-4-(4-methoxybutyl)-2,2-dimethyl-3-oxo-1,4-benzoxazine-6-carboxylate |
| SMILES | COCCCCN1C(=O)C(C)(C)Oc2cc(C(F)F)c(C(=O)OC)cc21 |
| InChI | InChI=1S/C18H23F2NO5/c1-18(2)17(23)21(7-5-6-8-24-3)13-9-12(16(22)25-4)11(15(19)20)10-14(13)26-18/h9-10,15H,5-8H2,1-4H3 |
| InChIKey | JHAQNFPFUVCAIO-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.38 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|