C26H35FN2O4 — CID 143814114
4-[5-(2-aminoacetyl)-2-fluorophenyl]-N-[(2R)-butan-2-yl]-3-(3-methoxypropoxy)-N-propan-2-ylbenzamide (PubChem CID 143814114) has the molecular formula C26H35FN2O4 and a molecular weight of 458.57 g/mol. Its IUPAC name is 4-[5-(2-aminoacetyl)-2-fluorophenyl]-N-[(2R)-butan-2-yl]-3-(3-methoxypropoxy)-N-propan-2-ylbenzamide.
| Compound Name | 4-[5-(2-aminoacetyl)-2-fluorophenyl]-N-[(2R)-butan-2-yl]-3-(3-methoxypropoxy)-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 143814114 |
| Molecular Formula | C26H35FN2O4 |
| Molecular Weight | 458.57 g/mol |
| Exact Mass | 458.26 |
| IUPAC Name | 4-[5-(2-aminoacetyl)-2-fluorophenyl]-N-[(2R)-butan-2-yl]-3-(3-methoxypropoxy)-N-propan-2-ylbenzamide |
| SMILES | CC[C@@H](C)N(C(=O)c1ccc(-c2cc(C(=O)CN)ccc2F)c(OCCCOC)c1)C(C)C |
| InChI | InChI=1S/C26H35FN2O4/c1-6-18(4)29(17(2)3)26(31)20-8-10-21(25(15-20)33-13-7-12-32-5)22-14-19(24(30)16-28)9-11-23(22)27/h8-11,14-15,17-18H,6-7,12-13,16,28H2,1-5H3/t18-/m1/s1 |
| InChIKey | LJVSLJIVYBNHRS-GOSISDBHSA-N |
| XLogP | 4.70 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.57 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|