C20H31F3N2O6S — CID 143729754
[3-(3-methoxypropoxy)-5-[[(2R)-1-(methylamino)butan-2-yl]-propan-2-ylcarbamoyl]phenyl] trifluoromethanesulfonate (PubChem CID 143729754) has the molecular formula C20H31F3N2O6S and a molecular weight of 484.54 g/mol. Its IUPAC name is [3-(3-methoxypropoxy)-5-[[(2R)-1-(methylamino)butan-2-yl]-propan-2-ylcarbamoyl]phenyl] trifluoromethanesulfonate.
| Compound Name | [3-(3-methoxypropoxy)-5-[[(2R)-1-(methylamino)butan-2-yl]-propan-2-ylcarbamoyl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 143729754 |
| Molecular Formula | C20H31F3N2O6S |
| Molecular Weight | 484.54 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | [3-(3-methoxypropoxy)-5-[[(2R)-1-(methylamino)butan-2-yl]-propan-2-ylcarbamoyl]phenyl] trifluoromethanesulfonate |
| SMILES | CC[C@H](CNC)N(C(=O)c1cc(OCCCOC)cc(OS(=O)(=O)C(F)(F)F)c1)C(C)C |
| InChI | InChI=1S/C20H31F3N2O6S/c1-6-16(13-24-4)25(14(2)3)19(26)15-10-17(30-9-7-8-29-5)12-18(11-15)31-32(27,28)20(21,22)23/h10-12,14,16,24H,6-9,13H2,1-5H3/t16-/m1/s1 |
| InChIKey | HNGNIENNOAZZDL-MRXNPFEDSA-N |
| XLogP | 3.18 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.54 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|