C15H18F6N2O9S2 — CID 158145520
3-[2-(dimethylamino)ethylcarbamoyl]-5-(trifluoromethylsulfonyloxy)benzoic acid;methyl trifluoromethanesulfonate (PubChem CID 158145520) has the molecular formula C15H18F6N2O9S2 and a molecular weight of 548.44 g/mol. Its IUPAC name is 3-[2-(dimethylamino)ethylcarbamoyl]-5-(trifluoromethylsulfonyloxy)benzoic acid;methyl trifluoromethanesulfonate.
| Compound Name | 3-[2-(dimethylamino)ethylcarbamoyl]-5-(trifluoromethylsulfonyloxy)benzoic acid;methyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 158145520 |
| Molecular Formula | C15H18F6N2O9S2 |
| Molecular Weight | 548.44 g/mol |
| Exact Mass | 548.04 |
| IUPAC Name | 3-[2-(dimethylamino)ethylcarbamoyl]-5-(trifluoromethylsulfonyloxy)benzoic acid;methyl trifluoromethanesulfonate |
| SMILES | CN(C)CCNC(=O)c1cc(OS(=O)(=O)C(F)(F)F)cc(C(=O)O)c1.COS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C13H15F3N2O6S.C2H3F3O3S/c1-18(2)4-3-17-11(19)8-5-9(12(20)21)7-10(6-8)24-25(22,23)13(14,15)16;1-8-9(6,7)2(3,4)5/h5-7H,3-4H2,1-2H3,(H,17,19)(H,20,21);1H3 |
| InChIKey | FULVDYGIFDESMR-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 156.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.44 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|