C17H23NO5 — CID 119202865
2-[cyclopropyl-[3-(3-methoxypropoxy)benzoyl]amino]propanoic acid (PubChem CID 119202865) has the molecular formula C17H23NO5 and a molecular weight of 321.37 g/mol. Its IUPAC name is 2-[cyclopropyl-[3-(3-methoxypropoxy)benzoyl]amino]propanoic acid.
| Compound Name | 2-[cyclopropyl-[3-(3-methoxypropoxy)benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 119202865 |
| Molecular Formula | C17H23NO5 |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 2-[cyclopropyl-[3-(3-methoxypropoxy)benzoyl]amino]propanoic acid |
| SMILES | COCCCOc1cccc(C(=O)N(C2CC2)C(C)C(=O)O)c1 |
| InChI | InChI=1S/C17H23NO5/c1-12(17(20)21)18(14-7-8-14)16(19)13-5-3-6-15(11-13)23-10-4-9-22-2/h3,5-6,11-12,14H,4,7-10H2,1-2H3,(H,20,21) |
| InChIKey | AXWXSBQKQQNCEU-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|