C25H44N2O3 — CID 44758079
N-[2-[di(propan-2-yl)amino]ethyl]-3,4-dipentoxybenzamide (PubChem CID 44758079) has the molecular formula C25H44N2O3 and a molecular weight of 420.64 g/mol. Its IUPAC name is N-[2-[di(propan-2-yl)amino]ethyl]-3,4-dipentoxybenzamide.
| Compound Name | N-[2-[di(propan-2-yl)amino]ethyl]-3,4-dipentoxybenzamide |
|---|---|
| PubChem CID | 44758079 |
| Molecular Formula | C25H44N2O3 |
| Molecular Weight | 420.64 g/mol |
| Exact Mass | 420.34 |
| IUPAC Name | N-[2-[di(propan-2-yl)amino]ethyl]-3,4-dipentoxybenzamide |
| SMILES | CCCCCOc1ccc(C(=O)NCCN(C(C)C)C(C)C)cc1OCCCCC |
| InChI | InChI=1S/C25H44N2O3/c1-7-9-11-17-29-23-14-13-22(19-24(23)30-18-12-10-8-2)25(28)26-15-16-27(20(3)4)21(5)6/h13-14,19-21H,7-12,15-18H2,1-6H3,(H,26,28) |
| InChIKey | XYCIEUNHTGCSOR-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.64 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|