C33H38O5 — CID 169098452
methyl 6-[3-(1-adamantyl)-4-(2-methoxyethoxymethoxy)phenyl]-1-methylnaphthalene-2-carboxylate (PubChem CID 169098452) has the molecular formula C33H38O5 and a molecular weight of 514.66 g/mol. Its IUPAC name is methyl 6-[3-(1-adamantyl)-4-(2-methoxyethoxymethoxy)phenyl]-1-methylnaphthalene-2-carboxylate.
| Compound Name | methyl 6-[3-(1-adamantyl)-4-(2-methoxyethoxymethoxy)phenyl]-1-methylnaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 169098452 |
| Molecular Formula | C33H38O5 |
| Molecular Weight | 514.66 g/mol |
| Exact Mass | 514.27 |
| IUPAC Name | methyl 6-[3-(1-adamantyl)-4-(2-methoxyethoxymethoxy)phenyl]-1-methylnaphthalene-2-carboxylate |
| SMILES | COCCOCOc1ccc(-c2ccc3c(C)c(C(=O)OC)ccc3c2)cc1C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C33H38O5/c1-21-28-7-4-25(15-27(28)5-8-29(21)32(34)36-3)26-6-9-31(38-20-37-11-10-35-2)30(16-26)33-17-22-12-23(18-33)14-24(13-22)19-33/h4-9,15-16,22-24H,10-14,17-20H2,1-3H3 |
| InChIKey | BNXPSZFZEIRBKK-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.66 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|