C34H39NO3 — CID 70229189
4-[7-(1-adamantyl)-6-(1-piperidin-1-ylethoxy)naphthalen-2-yl]benzoic acid (PubChem CID 70229189) has the molecular formula C34H39NO3 and a molecular weight of 509.69 g/mol. Its IUPAC name is 4-[7-(1-adamantyl)-6-(1-piperidin-1-ylethoxy)naphthalen-2-yl]benzoic acid.
| Compound Name | 4-[7-(1-adamantyl)-6-(1-piperidin-1-ylethoxy)naphthalen-2-yl]benzoic acid |
|---|---|
| PubChem CID | 70229189 |
| Molecular Formula | C34H39NO3 |
| Molecular Weight | 509.69 g/mol |
| Exact Mass | 509.29 |
| IUPAC Name | 4-[7-(1-adamantyl)-6-(1-piperidin-1-ylethoxy)naphthalen-2-yl]benzoic acid |
| SMILES | CC(Oc1cc2ccc(-c3ccc(C(=O)O)cc3)cc2cc1C12CC3CC(CC(C3)C1)C2)N1CCCCC1 |
| InChI | InChI=1S/C34H39NO3/c1-22(35-11-3-2-4-12-35)38-32-18-29-10-9-28(26-5-7-27(8-6-26)33(36)37)16-30(29)17-31(32)34-19-23-13-24(20-34)15-25(14-23)21-34/h5-10,16-18,22-25H,2-4,11-15,19-21H2,1H3,(H,36,37) |
| InChIKey | YXUFKOMVMNRCTE-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.69 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |